C17H17BrN2O2S — CID 139528327
5-(4-bromophenyl)-3-(2,3-dimethoxyphenyl)-2-sulfanyl-3,4-dihydropyrazole (PubChem CID 139528327) has the molecular formula C17H17BrN2O2S and a molecular weight of 393.31 g/mol. Its IUPAC name is 5-(4-bromophenyl)-3-(2,3-dimethoxyphenyl)-2-sulfanyl-3,4-dihydropyrazole.
| Compound Name | 5-(4-bromophenyl)-3-(2,3-dimethoxyphenyl)-2-sulfanyl-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 139528327 |
| Molecular Formula | C17H17BrN2O2S |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | 5-(4-bromophenyl)-3-(2,3-dimethoxyphenyl)-2-sulfanyl-3,4-dihydropyrazole |
| SMILES | COc1cccc(C2CC(c3ccc(Br)cc3)=NN2S)c1OC |
| InChI | InChI=1S/C17H17BrN2O2S/c1-21-16-5-3-4-13(17(16)22-2)15-10-14(19-20(15)23)11-6-8-12(18)9-7-11/h3-9,15,23H,10H2,1-2H3 |
| InChIKey | KLCTVIOHUZIJMT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 34.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|