C14H15IN2 — CID 139528330
2-[(1Z)-buta-1,3-dienyl]-5-iodo-3-methyl-1,5-dihydro-2,4-benzodiazepine (PubChem CID 139528330) has the molecular formula C14H15IN2 and a molecular weight of 338.19 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-5-iodo-3-methyl-1,5-dihydro-2,4-benzodiazepine.
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-5-iodo-3-methyl-1,5-dihydro-2,4-benzodiazepine |
|---|---|
| PubChem CID | 139528330 |
| Molecular Formula | C14H15IN2 |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-5-iodo-3-methyl-1,5-dihydro-2,4-benzodiazepine |
| SMILES | C=C/C=C\N1Cc2ccccc2C(I)N=C1C |
| InChI | InChI=1S/C14H15IN2/c1-3-4-9-17-10-12-7-5-6-8-13(12)14(15)16-11(17)2/h3-9,14H,1,10H2,2H3/b9-4- |
| InChIKey | QUQHVMSHCNTCQI-WTKPLQERSA-N |
| XLogP | 4.05 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|