C11H26N4 — CID 139528374
N'-methyl-N'-[(1-methylpiperazin-2-yl)methyl]butane-1,4-diamine (PubChem CID 139528374) has the molecular formula C11H26N4 and a molecular weight of 214.36 g/mol. Its IUPAC name is N'-methyl-N'-[(1-methylpiperazin-2-yl)methyl]butane-1,4-diamine.
| Compound Name | N'-methyl-N'-[(1-methylpiperazin-2-yl)methyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 139528374 |
| Molecular Formula | C11H26N4 |
| Molecular Weight | 214.36 g/mol |
| Exact Mass | 214.22 |
| IUPAC Name | N'-methyl-N'-[(1-methylpiperazin-2-yl)methyl]butane-1,4-diamine |
| SMILES | CN(CCCCN)CC1CNCCN1C |
| InChI | InChI=1S/C11H26N4/c1-14(7-4-3-5-12)10-11-9-13-6-8-15(11)2/h11,13H,3-10,12H2,1-2H3 |
| InChIKey | FCEXWWSQMXOUOV-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.36 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|