C12H18BrN — CID 139528488
N-[(1E,3Z,5E)-6-bromo-2-methylhepta-1,3,5-trienyl]-2-methylpropan-1-imine (PubChem CID 139528488) has the molecular formula C12H18BrN and a molecular weight of 256.19 g/mol. Its IUPAC name is N-[(1E,3Z,5E)-6-bromo-2-methylhepta-1,3,5-trienyl]-2-methylpropan-1-imine.
| Compound Name | N-[(1E,3Z,5E)-6-bromo-2-methylhepta-1,3,5-trienyl]-2-methylpropan-1-imine |
|---|---|
| PubChem CID | 139528488 |
| Molecular Formula | C12H18BrN |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | N-[(1E,3Z,5E)-6-bromo-2-methylhepta-1,3,5-trienyl]-2-methylpropan-1-imine |
| SMILES | C/C(Br)=C\C=C/C(C)=C/N=C/C(C)C |
| InChI | InChI=1S/C12H18BrN/c1-10(2)8-14-9-11(3)6-5-7-12(4)13/h5-10H,1-4H3/b6-5-,11-9+,12-7+,14-8+ |
| InChIKey | OSFOFWHXTVIZDI-NWALTOMYSA-N |
| XLogP | 4.47 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|