C22H25F2N7O — CID 139529175
(1R)-1-[8-(4,4-difluoropiperidin-1-yl)-2-(5,6,7,8-tetrahydro-1,6-naphthyridin-2-ylamino)pyrido[3,4-d]pyrimidin-6-yl]ethanol (PubChem CID 139529175) has the molecular formula C22H25F2N7O and a molecular weight of 441.49 g/mol. Its IUPAC name is (1R)-1-[8-(4,4-difluoropiperidin-1-yl)-2-(5,6,7,8-tetrahydro-1,6-naphthyridin-2-ylamino)pyrido[3,4-d]pyrimidin-6-yl]ethanol.
| Compound Name | (1R)-1-[8-(4,4-difluoropiperidin-1-yl)-2-(5,6,7,8-tetrahydro-1,6-naphthyridin-2-ylamino)pyrido[3,4-d]pyrimidin-6-yl]ethanol |
|---|---|
| PubChem CID | 139529175 |
| Molecular Formula | C22H25F2N7O |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | (1R)-1-[8-(4,4-difluoropiperidin-1-yl)-2-(5,6,7,8-tetrahydro-1,6-naphthyridin-2-ylamino)pyrido[3,4-d]pyrimidin-6-yl]ethanol |
| SMILES | C[C@@H](O)c1cc2cnc(Nc3ccc4c(n3)CCNC4)nc2c(N2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C22H25F2N7O/c1-13(32)17-10-15-12-26-21(29-18-3-2-14-11-25-7-4-16(14)27-18)30-19(15)20(28-17)31-8-5-22(23,24)6-9-31/h2-3,10,12-13,25,32H,4-9,11H2,1H3,(H,26,27,29,30)/t13-/m1/s1 |
| InChIKey | XWFDKBJGRMTHLH-CYBMUJFWSA-N |
| XLogP | 3.10 |
| TPSA | 99.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |