About 1-hydroxy-2-iminopyrimidine-4,5-diamine
1-hydroxy-2-iminopyrimidine-4,5-diamine (PubChem CID 139529678) has the molecular formula C4H7N5O
and a molecular weight of 141.13 g/mol. Its IUPAC name is 1-hydroxy-2-iminopyrimidine-4,5-diamine.
Molecular Properties
| Compound Name | 1-hydroxy-2-iminopyrimidine-4,5-diamine |
| PubChem CID | 139529678 |
| Molecular Formula | C4H7N5O |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.07 |
| IUPAC Name | 1-hydroxy-2-iminopyrimidine-4,5-diamine |
| SMILES | [H]/N=c1\nc(N)c(N)cn1O |
| InChI | InChI=1S/C4H7N5O/c5-2-1-9(10)4(7)8-3(2)6/h1,10H,5H2,(H3,6,7,8) |
| InChIKey | OAPSSGZSEVEJJO-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-2-iminopyrimidine-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-2-iminopyrimidine-4,5-diamine?
The IUPAC name of 1-hydroxy-2-iminopyrimidine-4,5-diamine (CID 139529678) is 1-hydroxy-2-iminopyrimidine-4,5-diamine.
What is the SMILES notation for 1-hydroxy-2-iminopyrimidine-4,5-diamine?
The canonical SMILES for 1-hydroxy-2-iminopyrimidine-4,5-diamine is [H]/N=c1\nc(N)c(N)cn1O.
What is the InChIKey of 1-hydroxy-2-iminopyrimidine-4,5-diamine?
The InChIKey is OAPSSGZSEVEJJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N5O/c5-2-1-9(10)4(7)8-3(2)6/h1,10H,5H2,(H3,6,7,8).
What are the key properties of 1-hydroxy-2-iminopyrimidine-4,5-diamine?
1-hydroxy-2-iminopyrimidine-4,5-diamine has a molecular weight of 141.13 g/mol, XLogP of -1.24, 0 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-2-iminopyrimidine-4,5-diamine is sourced from PubChem (CID 139529678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).