C13H23NO4 — CID 139529864
ethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonyl-prop-2-enylamino]propanoate (PubChem CID 139529864) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is ethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonyl-prop-2-enylamino]propanoate.
| Compound Name | ethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonyl-prop-2-enylamino]propanoate |
|---|---|
| PubChem CID | 139529864 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | ethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonyl-prop-2-enylamino]propanoate |
| SMILES | C=CCN(C(=O)OC(C)(C)C)[C@@H](C)C(=O)OCC |
| InChI | InChI=1S/C13H23NO4/c1-7-9-14(10(3)11(15)17-8-2)12(16)18-13(4,5)6/h7,10H,1,8-9H2,2-6H3/t10-/m0/s1 |
| InChIKey | OFMWWHCVPGWXST-JTQLQIEISA-N |
| XLogP | 2.36 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|