C18H21Cl2N3O3 — CID 139530003
5-[3-[4-(3,5-dichloro-2-methylphenyl)piperidin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione (PubChem CID 139530003) has the molecular formula C18H21Cl2N3O3 and a molecular weight of 398.29 g/mol. Its IUPAC name is 5-[3-[4-(3,5-dichloro-2-methylphenyl)piperidin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione.
| Compound Name | 5-[3-[4-(3,5-dichloro-2-methylphenyl)piperidin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 139530003 |
| Molecular Formula | C18H21Cl2N3O3 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 5-[3-[4-(3,5-dichloro-2-methylphenyl)piperidin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione |
| SMILES | Cc1c(Cl)cc(Cl)cc1C1CCN(C(=O)CCC2NC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C18H21Cl2N3O3/c1-10-13(8-12(19)9-14(10)20)11-4-6-23(7-5-11)16(24)3-2-15-17(25)22-18(26)21-15/h8-9,11,15H,2-7H2,1H3,(H2,21,22,25,26) |
| InChIKey | ILPKQVLOAJOEHM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|