C32H34IN7O4 — CID 139530833
4-[8-[2-[3-[(6-iodo-3-pyridinyl)oxy]cyclobutyl]oxy-4-pyridinyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]-6-[2-(methoxymethoxy)phenyl]pyridazin-3-amine (PubChem CID 139530833) has the molecular formula C32H34IN7O4 and a molecular weight of 707.57 g/mol. Its IUPAC name is 4-[8-[2-[3-[(6-iodo-3-pyridinyl)oxy]cyclobutyl]oxy-4-pyridinyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]-6-[2-(methoxymethoxy)phenyl]pyridazin-3-amine.
| Compound Name | 4-[8-[2-[3-[(6-iodo-3-pyridinyl)oxy]cyclobutyl]oxy-4-pyridinyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]-6-[2-(methoxymethoxy)phenyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 139530833 |
| Molecular Formula | C32H34IN7O4 |
| Molecular Weight | 707.57 g/mol |
| Exact Mass | 707.17 |
| IUPAC Name | 4-[8-[2-[3-[(6-iodo-3-pyridinyl)oxy]cyclobutyl]oxy-4-pyridinyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]-6-[2-(methoxymethoxy)phenyl]pyridazin-3-amine |
| SMILES | COCOc1ccccc1-c1cc(N2CC3CCC(C2)N3c2ccnc(OC3CC(Oc4ccc(I)nc4)C3)c2)c(N)nn1 |
| InChI | InChI=1S/C32H34IN7O4/c1-41-19-42-29-5-3-2-4-26(29)27-15-28(32(34)38-37-27)39-17-21-6-7-22(18-39)40(21)20-10-11-35-31(12-20)44-25-13-24(14-25)43-23-8-9-30(33)36-16-23/h2-5,8-12,15-16,21-22,24-25H,6-7,13-14,17-19H2,1H3,(H2,34,38) |
| InChIKey | UUPWLKYBEKDELQ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.57 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|