About 1,5-dimethyl-2H-tetrazine
1,5-dimethyl-2H-tetrazine (PubChem CID 139532843) has the molecular formula C4H8N4
and a molecular weight of 112.14 g/mol. Its IUPAC name is 1,5-dimethyl-2H-tetrazine.
Molecular Properties
| Compound Name | 1,5-dimethyl-2H-tetrazine |
| PubChem CID | 139532843 |
| Molecular Formula | C4H8N4 |
| Molecular Weight | 112.14 g/mol |
| Exact Mass | 112.07 |
| IUPAC Name | 1,5-dimethyl-2H-tetrazine |
| SMILES | CC1=CN(C)NN=N1 |
| InChI | InChI=1S/C4H8N4/c1-4-3-8(2)7-6-5-4/h3H,1-2H3,(H,5,7) |
| InChIKey | NKCNZSUSRXOXCG-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.14 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,5-dimethyl-2H-tetrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-2H-tetrazine?
The IUPAC name of 1,5-dimethyl-2H-tetrazine (CID 139532843) is 1,5-dimethyl-2H-tetrazine.
What is the SMILES notation for 1,5-dimethyl-2H-tetrazine?
The canonical SMILES for 1,5-dimethyl-2H-tetrazine is CC1=CN(C)NN=N1.
What is the InChIKey of 1,5-dimethyl-2H-tetrazine?
The InChIKey is NKCNZSUSRXOXCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N4/c1-4-3-8(2)7-6-5-4/h3H,1-2H3,(H,5,7).
What are the key properties of 1,5-dimethyl-2H-tetrazine?
1,5-dimethyl-2H-tetrazine has a molecular weight of 112.14 g/mol, XLogP of 0.66, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-2H-tetrazine is sourced from PubChem (CID 139532843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).