C26H18Br2F2N2 — CID 139533033
N-[1-(3,6-dibromo-2-pyridinyl)-2-(3,5-difluorophenyl)ethyl]-1,1-diphenylmethanimine (PubChem CID 139533033) has the molecular formula C26H18Br2F2N2 and a molecular weight of 556.25 g/mol. Its IUPAC name is N-[1-(3,6-dibromo-2-pyridinyl)-2-(3,5-difluorophenyl)ethyl]-1,1-diphenylmethanimine.
| Compound Name | N-[1-(3,6-dibromo-2-pyridinyl)-2-(3,5-difluorophenyl)ethyl]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 139533033 |
| Molecular Formula | C26H18Br2F2N2 |
| Molecular Weight | 556.25 g/mol |
| Exact Mass | 553.98 |
| IUPAC Name | N-[1-(3,6-dibromo-2-pyridinyl)-2-(3,5-difluorophenyl)ethyl]-1,1-diphenylmethanimine |
| SMILES | Fc1cc(F)cc(CC(N=C(c2ccccc2)c2ccccc2)c2nc(Br)ccc2Br)c1 |
| InChI | InChI=1S/C26H18Br2F2N2/c27-22-11-12-24(28)32-26(22)23(15-17-13-20(29)16-21(30)14-17)31-25(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-14,16,23H,15H2 |
| InChIKey | SQIMKRRCCBHUPV-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.25 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|