C31H31F4N6O5P — CID 139533083
[4-[2-(2,6-diethylphenyl)-5-[5-(trifluoromethyl)pyrimidin-2-yl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]-5-fluoro-1H-indol-7-yl]methoxymethyl dihydrogen phosphate (PubChem CID 139533083) has the molecular formula C31H31F4N6O5P and a molecular weight of 674.59 g/mol. Its IUPAC name is [4-[2-(2,6-diethylphenyl)-5-[5-(trifluoromethyl)pyrimidin-2-yl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]-5-fluoro-1H-indol-7-yl]methoxymethyl dihydrogen phosphate.
| Compound Name | [4-[2-(2,6-diethylphenyl)-5-[5-(trifluoromethyl)pyrimidin-2-yl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]-5-fluoro-1H-indol-7-yl]methoxymethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 139533083 |
| Molecular Formula | C31H31F4N6O5P |
| Molecular Weight | 674.59 g/mol |
| Exact Mass | 674.20 |
| IUPAC Name | [4-[2-(2,6-diethylphenyl)-5-[5-(trifluoromethyl)pyrimidin-2-yl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]-5-fluoro-1H-indol-7-yl]methoxymethyl dihydrogen phosphate |
| SMILES | CCc1cccc(CC)c1-n1nc2c(c1-c1c(F)cc(COCOP(=O)(O)O)c3[nH]ccc13)CN(c1ncc(C(F)(F)F)cn1)CC2 |
| InChI | InChI=1S/C31H31F4N6O5P/c1-3-18-6-5-7-19(4-2)28(18)41-29(23-15-40(11-9-25(23)39-41)30-37-13-21(14-38-30)31(33,34)35)26-22-8-10-36-27(22)20(12-24(26)32)16-45-17-46-47(42,43)44/h5-8,10,12-14,36H,3-4,9,11,15-17H2,1-2H3,(H2,42,43,44) |
| InChIKey | JRFPHDDNVGYULX-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 138.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.59 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|