C78H51N7 — CID 139533350
3-[2-[2,6-bis(2,6-diphenyl-4-pyridinyl)-4-pyridinyl]-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-phenylcarbazole (PubChem CID 139533350) has the molecular formula C78H51N7 and a molecular weight of 1086.32 g/mol. Its IUPAC name is 3-[2-[2,6-bis(2,6-diphenyl-4-pyridinyl)-4-pyridinyl]-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-phenylcarbazole.
| Compound Name | 3-[2-[2,6-bis(2,6-diphenyl-4-pyridinyl)-4-pyridinyl]-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 139533350 |
| Molecular Formula | C78H51N7 |
| Molecular Weight | 1086.32 g/mol |
| Exact Mass | 1085.42 |
| IUPAC Name | 3-[2-[2,6-bis(2,6-diphenyl-4-pyridinyl)-4-pyridinyl]-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-phenylcarbazole |
| SMILES | c1ccc(-c2cc(-c3cc(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4-c4ccc5c(c4)c4ccccc4n5-c4ccccc4)cc(-c4cc(-c5ccccc5)nc(-c5ccccc5)c4)n3)cc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C78H51N7/c1-8-24-52(25-9-1)68-48-61(49-69(79-68)53-26-10-2-11-27-53)72-46-60(47-73(81-72)62-50-70(54-28-12-3-13-29-54)80-71(51-62)55-30-14-4-15-31-55)64-42-40-59(78-83-76(56-32-16-5-17-33-56)82-77(84-78)57-34-18-6-19-35-57)45-66(64)58-41-43-75-67(44-58)65-38-22-23-39-74(65)85(75)63-36-20-7-21-37-63/h1-51H |
| InChIKey | TXDGALKSGQDZNU-UHFFFAOYSA-N |
| XLogP | 19.49 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1086.32 |
| LogP ≤ 5 | 19.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |