About hydron;pyrrolo[2,3-c]pyridin-7-one
hydron;pyrrolo[2,3-c]pyridin-7-one (PubChem CID 139533632) has the molecular formula C7H5N2O+
and a molecular weight of 133.13 g/mol. Its IUPAC name is hydron;pyrrolo[2,3-c]pyridin-7-one.
Molecular Properties
| Compound Name | hydron;pyrrolo[2,3-c]pyridin-7-one |
|---|
| PubChem CID | 139533632 |
|---|
| Molecular Formula | C7H5N2O+ |
|---|
| Molecular Weight | 133.13 g/mol |
|---|
| Exact Mass | 133.04 |
|---|
| IUPAC Name | hydron;pyrrolo[2,3-c]pyridin-7-one |
|---|
| SMILES | O=C1N=CC=C2C=CN=C12.[H+] |
|---|
| InChI | InChI=1S/C7H4N2O/c10-7-6-5(1-3-8-6)2-4-9-7/h1-4H/p+1 |
|---|
| InChIKey | XFAWJIWICBTYDC-UHFFFAOYSA-O |
|---|
| XLogP | 0.60 |
|---|
| TPSA | 41.79 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 2 |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 10 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 133.13 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze hydron;pyrrolo[2,3-c]pyridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;pyrrolo[2,3-c]pyridin-7-one?
The IUPAC name of hydron;pyrrolo[2,3-c]pyridin-7-one (CID 139533632) is hydron;pyrrolo[2,3-c]pyridin-7-one.
What is the SMILES notation for hydron;pyrrolo[2,3-c]pyridin-7-one?
The canonical SMILES for hydron;pyrrolo[2,3-c]pyridin-7-one is O=C1N=CC=C2C=CN=C12.[H+].
What is the InChIKey of hydron;pyrrolo[2,3-c]pyridin-7-one?
The InChIKey is XFAWJIWICBTYDC-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H4N2O/c10-7-6-5(1-3-8-6)2-4-9-7/h1-4H/p+1.
What are the key properties of hydron;pyrrolo[2,3-c]pyridin-7-one?
hydron;pyrrolo[2,3-c]pyridin-7-one has a molecular weight of 133.13 g/mol, XLogP of 0.60, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;pyrrolo[2,3-c]pyridin-7-one is sourced from PubChem (CID 139533632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).