C10H4F6O8S2 — CID 139533722
bis(trifluoromethylsulfonyl) benzene-1,3-dicarboxylate (PubChem CID 139533722) has the molecular formula C10H4F6O8S2 and a molecular weight of 430.26 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl) benzene-1,3-dicarboxylate.
| Compound Name | bis(trifluoromethylsulfonyl) benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 139533722 |
| Molecular Formula | C10H4F6O8S2 |
| Molecular Weight | 430.26 g/mol |
| Exact Mass | 429.93 |
| IUPAC Name | bis(trifluoromethylsulfonyl) benzene-1,3-dicarboxylate |
| SMILES | O=C(OS(=O)(=O)C(F)(F)F)c1cccc(C(=O)OS(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H4F6O8S2/c11-9(12,13)25(19,20)23-7(17)5-2-1-3-6(4-5)8(18)24-26(21,22)10(14,15)16/h1-4H |
| InChIKey | XNMINGIVQBBJRR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|