C22H32N2O6S4 — CID 139533778
3-[2-[2-[2-[2-[1-(3-sulfonatopropyl)pyridin-1-ium-2-yl]ethylsulfanyl]ethylsulfanyl]ethyl]pyridin-1-ium-1-yl]propane-1-sulfonate (PubChem CID 139533778) has the molecular formula C22H32N2O6S4 and a molecular weight of 548.77 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-[1-(3-sulfonatopropyl)pyridin-1-ium-2-yl]ethylsulfanyl]ethylsulfanyl]ethyl]pyridin-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[2-[2-[2-[2-[1-(3-sulfonatopropyl)pyridin-1-ium-2-yl]ethylsulfanyl]ethylsulfanyl]ethyl]pyridin-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 139533778 |
| Molecular Formula | C22H32N2O6S4 |
| Molecular Weight | 548.77 g/mol |
| Exact Mass | 548.11 |
| IUPAC Name | 3-[2-[2-[2-[2-[1-(3-sulfonatopropyl)pyridin-1-ium-2-yl]ethylsulfanyl]ethylsulfanyl]ethyl]pyridin-1-ium-1-yl]propane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCC[n+]1ccccc1CCSCCSCCc1cccc[n+]1CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C22H32N2O6S4/c25-33(26,27)19-5-13-23-11-3-1-7-21(23)9-15-31-17-18-32-16-10-22-8-2-4-12-24(22)14-6-20-34(28,29)30/h1-4,7-8,11-12H,5-6,9-10,13-20H2 |
| InChIKey | IPNPWKIWIKMBKQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 122.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.77 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|