About 2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-cyclohexane]-1'-yl]acetic acid
2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-cyclohexane]-1'-yl]acetic acid (PubChem CID 139533871) has the molecular formula C16H17F3O3
and a molecular weight of 314.30 g/mol. Its IUPAC name is 2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-cyclohexane]-1'-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-cyclohexane]-1'-yl]acetic acid |
| PubChem CID | 139533871 |
| Molecular Formula | C16H17F3O3 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-cyclohexane]-1'-yl]acetic acid |
| SMILES | O=C(O)CC1CCC2(CC1)COc1cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C16H17F3O3/c17-16(18,19)11-1-2-12-13(8-11)22-9-15(12)5-3-10(4-6-15)7-14(20)21/h1-2,8,10H,3-7,9H2,(H,20,21) |
| InChIKey | WEOKUWHQJFPLEQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-cyclohexane]-1'-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-cyclohexane]-1'-yl]acetic acid?
The IUPAC name of 2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-cyclohexane]-1'-yl]acetic acid (CID 139533871) is 2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-cyclohexane]-1'-yl]acetic acid.
What is the SMILES notation for 2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-cyclohexane]-1'-yl]acetic acid?
The canonical SMILES for 2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-cyclohexane]-1'-yl]acetic acid is O=C(O)CC1CCC2(CC1)COc1cc(C(F)(F)F)ccc12.
What is the InChIKey of 2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-cyclohexane]-1'-yl]acetic acid?
The InChIKey is WEOKUWHQJFPLEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F3O3/c17-16(18,19)11-1-2-12-13(8-11)22-9-15(12)5-3-10(4-6-15)7-14(20)21/h1-2,8,10H,3-7,9H2,(H,20,21).
What are the key properties of 2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-cyclohexane]-1'-yl]acetic acid?
2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-cyclohexane]-1'-yl]acetic acid has a molecular weight of 314.30 g/mol, XLogP of 4.00, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-cyclohexane]-1'-yl]acetic acid is sourced from PubChem (CID 139533871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).