About CID 139533902
CID 139533902 (PubChem CID 139533902) has the molecular formula C15H16F3NO3
and a molecular weight of 315.29 g/mol.
Molecular Properties
| Compound Name | CID 139533902 |
| PubChem CID | 139533902 |
| Molecular Formula | C15H16F3NO3 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | — |
| SMILES | FC(F)(F)c1ccc2c(n1)OCC21CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C15H16F3NO3/c16-15(17,18)11-2-1-10-12(19-11)20-9-13(10)3-5-14(6-4-13)21-7-8-22-14/h1-2H,3-9H2 |
| InChIKey | FQPOJWUJKYFIIN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 139533902 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139533902?
The IUPAC name of CID 139533902 (CID 139533902) is not available.
What is the SMILES notation for CID 139533902?
The canonical SMILES for CID 139533902 is FC(F)(F)c1ccc2c(n1)OCC21CCC2(CC1)OCCO2.
What is the InChIKey of CID 139533902?
The InChIKey is FQPOJWUJKYFIIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16F3NO3/c16-15(17,18)11-2-1-10-12(19-11)20-9-13(10)3-5-14(6-4-13)21-7-8-22-14/h1-2H,3-9H2.
What are the key properties of CID 139533902?
CID 139533902 has a molecular weight of 315.29 g/mol, XLogP of 3.05, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139533902 is sourced from PubChem (CID 139533902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).