C13H11F3N3O4+ — CID 139533984
(2,2,2-trifluoroacetyl) 3-[4-(5-methyl-1,3-oxazol-2-yl)pyridazin-1-ium-1-yl]propanoate (PubChem CID 139533984) has the molecular formula C13H11F3N3O4+ and a molecular weight of 330.24 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-[4-(5-methyl-1,3-oxazol-2-yl)pyridazin-1-ium-1-yl]propanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-[4-(5-methyl-1,3-oxazol-2-yl)pyridazin-1-ium-1-yl]propanoate |
|---|---|
| PubChem CID | 139533984 |
| Molecular Formula | C13H11F3N3O4+ |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-[4-(5-methyl-1,3-oxazol-2-yl)pyridazin-1-ium-1-yl]propanoate |
| SMILES | Cc1cnc(-c2cc[n+](CCC(=O)OC(=O)C(F)(F)F)nc2)o1 |
| InChI | InChI=1S/C13H11F3N3O4/c1-8-6-17-11(22-8)9-2-4-19(18-7-9)5-3-10(20)23-12(21)13(14,15)16/h2,4,6-7H,3,5H2,1H3/q+1 |
| InChIKey | KRCMAPXQFSPENK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 86.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|