About 5-pyridazin-4-yl-1,2,4-thiadiazole
5-pyridazin-4-yl-1,2,4-thiadiazole (PubChem CID 139534008) has the molecular formula C6H4N4S
and a molecular weight of 164.19 g/mol. Its IUPAC name is 5-pyridazin-4-yl-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 5-pyridazin-4-yl-1,2,4-thiadiazole |
| PubChem CID | 139534008 |
| Molecular Formula | C6H4N4S |
| Molecular Weight | 164.19 g/mol |
| Exact Mass | 164.02 |
| IUPAC Name | 5-pyridazin-4-yl-1,2,4-thiadiazole |
| SMILES | c1cc(-c2ncns2)cnn1 |
| InChI | InChI=1S/C6H4N4S/c1-2-8-9-3-5(1)6-7-4-10-11-6/h1-4H |
| InChIKey | CJZFZCPUOBOIEP-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.19 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-pyridazin-4-yl-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyridazin-4-yl-1,2,4-thiadiazole?
The IUPAC name of 5-pyridazin-4-yl-1,2,4-thiadiazole (CID 139534008) is 5-pyridazin-4-yl-1,2,4-thiadiazole.
What is the SMILES notation for 5-pyridazin-4-yl-1,2,4-thiadiazole?
The canonical SMILES for 5-pyridazin-4-yl-1,2,4-thiadiazole is c1cc(-c2ncns2)cnn1.
What is the InChIKey of 5-pyridazin-4-yl-1,2,4-thiadiazole?
The InChIKey is CJZFZCPUOBOIEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4S/c1-2-8-9-3-5(1)6-7-4-10-11-6/h1-4H.
What are the key properties of 5-pyridazin-4-yl-1,2,4-thiadiazole?
5-pyridazin-4-yl-1,2,4-thiadiazole has a molecular weight of 164.19 g/mol, XLogP of 1.00, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyridazin-4-yl-1,2,4-thiadiazole is sourced from PubChem (CID 139534008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).