About (4S)-3,3-difluoro-4-(4-formylpyrazol-1-yl)piperidine-1-carboxylic acid
(4S)-3,3-difluoro-4-(4-formylpyrazol-1-yl)piperidine-1-carboxylic acid (PubChem CID 139535640) has the molecular formula C10H11F2N3O3
and a molecular weight of 259.21 g/mol. Its IUPAC name is (4S)-3,3-difluoro-4-(4-formylpyrazol-1-yl)piperidine-1-carboxylic acid.
Molecular Properties
| Compound Name | (4S)-3,3-difluoro-4-(4-formylpyrazol-1-yl)piperidine-1-carboxylic acid |
| PubChem CID | 139535640 |
| Molecular Formula | C10H11F2N3O3 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | (4S)-3,3-difluoro-4-(4-formylpyrazol-1-yl)piperidine-1-carboxylic acid |
| SMILES | O=Cc1cnn([C@H]2CCN(C(=O)O)CC2(F)F)c1 |
| InChI | InChI=1S/C10H11F2N3O3/c11-10(12)6-14(9(17)18)2-1-8(10)15-4-7(5-16)3-13-15/h3-5,8H,1-2,6H2,(H,17,18)/t8-/m0/s1 |
| InChIKey | UIWLGUMEVUBRTQ-QMMMGPOBSA-N |
| XLogP | 1.26 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (4S)-3,3-difluoro-4-(4-formylpyrazol-1-yl)piperidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-3,3-difluoro-4-(4-formylpyrazol-1-yl)piperidine-1-carboxylic acid?
The IUPAC name of (4S)-3,3-difluoro-4-(4-formylpyrazol-1-yl)piperidine-1-carboxylic acid (CID 139535640) is (4S)-3,3-difluoro-4-(4-formylpyrazol-1-yl)piperidine-1-carboxylic acid.
What is the SMILES notation for (4S)-3,3-difluoro-4-(4-formylpyrazol-1-yl)piperidine-1-carboxylic acid?
The canonical SMILES for (4S)-3,3-difluoro-4-(4-formylpyrazol-1-yl)piperidine-1-carboxylic acid is O=Cc1cnn([C@H]2CCN(C(=O)O)CC2(F)F)c1.
What is the InChIKey of (4S)-3,3-difluoro-4-(4-formylpyrazol-1-yl)piperidine-1-carboxylic acid?
The InChIKey is UIWLGUMEVUBRTQ-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H11F2N3O3/c11-10(12)6-14(9(17)18)2-1-8(10)15-4-7(5-16)3-13-15/h3-5,8H,1-2,6H2,(H,17,18)/t8-/m0/s1.
What are the key properties of (4S)-3,3-difluoro-4-(4-formylpyrazol-1-yl)piperidine-1-carboxylic acid?
(4S)-3,3-difluoro-4-(4-formylpyrazol-1-yl)piperidine-1-carboxylic acid has a molecular weight of 259.21 g/mol, XLogP of 1.26, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-3,3-difluoro-4-(4-formylpyrazol-1-yl)piperidine-1-carboxylic acid is sourced from PubChem (CID 139535640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).