C24H28F3N7O2 — CID 139536397
[2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]-5-(1H-pyrazol-5-yl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 139536397) has the molecular formula C24H28F3N7O2 and a molecular weight of 503.53 g/mol. Its IUPAC name is [2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]-5-(1H-pyrazol-5-yl)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]-5-(1H-pyrazol-5-yl)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 139536397 |
| Molecular Formula | C24H28F3N7O2 |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | [2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]-5-(1H-pyrazol-5-yl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | CN(c1ncc(-c2ccc(-c3ccn[nH]3)cc2OC(=O)C(F)(F)F)nn1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C24H28F3N7O2/c1-22(2)11-15(12-23(3,4)33-22)34(5)21-28-13-18(31-32-21)16-7-6-14(17-8-9-29-30-17)10-19(16)36-20(35)24(25,26)27/h6-10,13,15,33H,11-12H2,1-5H3,(H,29,30) |
| InChIKey | NPNOQXTUELBWJC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|