C22H21F3N6O3 — CID 139536419
[2-[3-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-1,2,4-triazin-6-yl]-5-(1,3-oxazol-2-yl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 139536419) has the molecular formula C22H21F3N6O3 and a molecular weight of 474.44 g/mol. Its IUPAC name is [2-[3-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-1,2,4-triazin-6-yl]-5-(1,3-oxazol-2-yl)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[3-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-1,2,4-triazin-6-yl]-5-(1,3-oxazol-2-yl)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 139536419 |
| Molecular Formula | C22H21F3N6O3 |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | [2-[3-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-1,2,4-triazin-6-yl]-5-(1,3-oxazol-2-yl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | CN1CCC2(CC1)CN(c1ncc(-c3ccc(-c4ncco4)cc3OC(=O)C(F)(F)F)nn1)C2 |
| InChI | InChI=1S/C22H21F3N6O3/c1-30-7-4-21(5-8-30)12-31(13-21)20-27-11-16(28-29-20)15-3-2-14(18-26-6-9-33-18)10-17(15)34-19(32)22(23,24)25/h2-3,6,9-11H,4-5,7-8,12-13H2,1H3 |
| InChIKey | LXNQGYAIJLNZOK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 97.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|