C22H28N6O2 — CID 139536504
2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]-5-(1,3-oxazol-2-yl)phenol (PubChem CID 139536504) has the molecular formula C22H28N6O2 and a molecular weight of 408.51 g/mol. Its IUPAC name is 2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]-5-(1,3-oxazol-2-yl)phenol.
| Compound Name | 2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]-5-(1,3-oxazol-2-yl)phenol |
|---|---|
| PubChem CID | 139536504 |
| Molecular Formula | C22H28N6O2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]-5-(1,3-oxazol-2-yl)phenol |
| SMILES | CN(c1ncc(-c2ccc(-c3ncco3)cc2O)nn1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C22H28N6O2/c1-21(2)11-15(12-22(3,4)27-21)28(5)20-24-13-17(25-26-20)16-7-6-14(10-18(16)29)19-23-8-9-30-19/h6-10,13,15,27,29H,11-12H2,1-5H3 |
| InChIKey | DAFHXYJYWZLBLR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 100.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |