C24H27F3N6O3 — CID 139536675
[5-(1-methylpyrazol-3-yl)-2-[3-(2,2,6,6-tetramethylpiperidin-4-yl)oxy-1,2,4-triazin-6-yl]phenyl] 2,2,2-trifluoroacetate (PubChem CID 139536675) has the molecular formula C24H27F3N6O3 and a molecular weight of 504.51 g/mol. Its IUPAC name is [5-(1-methylpyrazol-3-yl)-2-[3-(2,2,6,6-tetramethylpiperidin-4-yl)oxy-1,2,4-triazin-6-yl]phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [5-(1-methylpyrazol-3-yl)-2-[3-(2,2,6,6-tetramethylpiperidin-4-yl)oxy-1,2,4-triazin-6-yl]phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 139536675 |
| Molecular Formula | C24H27F3N6O3 |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | [5-(1-methylpyrazol-3-yl)-2-[3-(2,2,6,6-tetramethylpiperidin-4-yl)oxy-1,2,4-triazin-6-yl]phenyl] 2,2,2-trifluoroacetate |
| SMILES | Cn1ccc(-c2ccc(-c3cnc(OC4CC(C)(C)NC(C)(C)C4)nn3)c(OC(=O)C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C24H27F3N6O3/c1-22(2)11-15(12-23(3,4)32-22)35-21-28-13-18(29-30-21)16-7-6-14(17-8-9-33(5)31-17)10-19(16)36-20(34)24(25,26)27/h6-10,13,15,32H,11-12H2,1-5H3 |
| InChIKey | KCHHKWHACZKYMF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|