C22H25F4N9O2 — CID 139536679
[2-[3-[[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,2,4-triazin-6-yl]-5-(2-methyltetrazol-5-yl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 139536679) has the molecular formula C22H25F4N9O2 and a molecular weight of 523.50 g/mol. Its IUPAC name is [2-[3-[[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,2,4-triazin-6-yl]-5-(2-methyltetrazol-5-yl)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[3-[[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,2,4-triazin-6-yl]-5-(2-methyltetrazol-5-yl)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 139536679 |
| Molecular Formula | C22H25F4N9O2 |
| Molecular Weight | 523.50 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | [2-[3-[[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,2,4-triazin-6-yl]-5-(2-methyltetrazol-5-yl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | Cn1nnc(-c2ccc(-c3cnc(N[C@H]4CC(C)(C)NC(C)(C)[C@H]4F)nn3)c(OC(=O)C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C22H25F4N9O2/c1-20(2)9-13(16(23)21(3,4)33-20)28-19-27-10-14(29-31-19)12-7-6-11(17-30-34-35(5)32-17)8-15(12)37-18(36)22(24,25)26/h6-8,10,13,16,33H,9H2,1-5H3,(H,27,28,31)/t13-,16-/m0/s1 |
| InChIKey | LIBDWFONENAUOG-BBRMVZONSA-N |
| XLogP | 2.87 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|