C27H33N7O2 — CID 139536851
5-(2,7-dimethyl-[1,3]oxazolo[5,4-b]pyridin-5-yl)-2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol (PubChem CID 139536851) has the molecular formula C27H33N7O2 and a molecular weight of 487.61 g/mol. Its IUPAC name is 5-(2,7-dimethyl-[1,3]oxazolo[5,4-b]pyridin-5-yl)-2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol.
| Compound Name | 5-(2,7-dimethyl-[1,3]oxazolo[5,4-b]pyridin-5-yl)-2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol |
|---|---|
| PubChem CID | 139536851 |
| Molecular Formula | C27H33N7O2 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | 5-(2,7-dimethyl-[1,3]oxazolo[5,4-b]pyridin-5-yl)-2-[3-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol |
| SMILES | Cc1nc2c(C)cc(-c3ccc(-c4cnc(N(C)C5CC(C)(C)NC(C)(C)C5)nn4)c(O)c3)nc2o1 |
| InChI | InChI=1S/C27H33N7O2/c1-15-10-20(30-24-23(15)29-16(2)36-24)17-8-9-19(22(35)11-17)21-14-28-25(32-31-21)34(7)18-12-26(3,4)33-27(5,6)13-18/h8-11,14,18,33,35H,12-13H2,1-7H3 |
| InChIKey | FPYOMQWLSUCCFM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |