C23H25F3N8O2 — CID 139536854
[2-[3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]-5-(1,2,4-triazin-6-yl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 139536854) has the molecular formula C23H25F3N8O2 and a molecular weight of 502.50 g/mol. Its IUPAC name is [2-[3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]-5-(1,2,4-triazin-6-yl)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]-5-(1,2,4-triazin-6-yl)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 139536854 |
| Molecular Formula | C23H25F3N8O2 |
| Molecular Weight | 502.50 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | [2-[3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]-5-(1,2,4-triazin-6-yl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | CC1(C)CC(Nc2ncc(-c3ccc(-c4cncnn4)cc3OC(=O)C(F)(F)F)nn2)CC(C)(C)N1 |
| InChI | InChI=1S/C23H25F3N8O2/c1-21(2)8-14(9-22(3,4)34-21)30-20-28-11-17(32-33-20)15-6-5-13(16-10-27-12-29-31-16)7-18(15)36-19(35)23(24,25)26/h5-7,10-12,14,34H,8-9H2,1-4H3,(H,28,30,33) |
| InChIKey | QODBOQJEESLJSH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 127.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|