C22H29N7O — CID 139536927
5-(1-methylpyrazol-4-yl)-2-[3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol (PubChem CID 139536927) has the molecular formula C22H29N7O and a molecular weight of 407.52 g/mol. Its IUPAC name is 5-(1-methylpyrazol-4-yl)-2-[3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol.
| Compound Name | 5-(1-methylpyrazol-4-yl)-2-[3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol |
|---|---|
| PubChem CID | 139536927 |
| Molecular Formula | C22H29N7O |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | 5-(1-methylpyrazol-4-yl)-2-[3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,2,4-triazin-6-yl]phenol |
| SMILES | Cn1cc(-c2ccc(-c3cnc(NC4CC(C)(C)NC(C)(C)C4)nn3)c(O)c2)cn1 |
| InChI | InChI=1S/C22H29N7O/c1-21(2)9-16(10-22(3,4)28-21)25-20-23-12-18(26-27-20)17-7-6-14(8-19(17)30)15-11-24-29(5)13-15/h6-8,11-13,16,28,30H,9-10H2,1-5H3,(H,23,25,27) |
| InChIKey | TWAQQEOIIQZKOT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |