C22H23F4N7O2S — CID 139536964
[2-[3-[[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,2,4-triazin-6-yl]-5-(1,2,4-thiadiazol-5-yl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 139536964) has the molecular formula C22H23F4N7O2S and a molecular weight of 525.53 g/mol. Its IUPAC name is [2-[3-[[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,2,4-triazin-6-yl]-5-(1,2,4-thiadiazol-5-yl)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[3-[[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,2,4-triazin-6-yl]-5-(1,2,4-thiadiazol-5-yl)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 139536964 |
| Molecular Formula | C22H23F4N7O2S |
| Molecular Weight | 525.53 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | [2-[3-[[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,2,4-triazin-6-yl]-5-(1,2,4-thiadiazol-5-yl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | CC1(C)C[C@H](Nc2ncc(-c3ccc(-c4ncns4)cc3OC(=O)C(F)(F)F)nn2)[C@H](F)C(C)(C)N1 |
| InChI | InChI=1S/C22H23F4N7O2S/c1-20(2)8-13(16(23)21(3,4)33-20)30-19-27-9-14(31-32-19)12-6-5-11(17-28-10-29-36-17)7-15(12)35-18(34)22(24,25)26/h5-7,9-10,13,16,33H,8H2,1-4H3,(H,27,30,32)/t13-,16-/m0/s1 |
| InChIKey | BFGHROMVVVGHJB-BBRMVZONSA-N |
| XLogP | 4.19 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|