C23H24F4N6O3 — CID 139537091
[2-[3-[[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,2,4-triazin-6-yl]-5-(1,3-oxazol-2-yl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 139537091) has the molecular formula C23H24F4N6O3 and a molecular weight of 508.48 g/mol. Its IUPAC name is [2-[3-[[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,2,4-triazin-6-yl]-5-(1,3-oxazol-2-yl)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[3-[[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,2,4-triazin-6-yl]-5-(1,3-oxazol-2-yl)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 139537091 |
| Molecular Formula | C23H24F4N6O3 |
| Molecular Weight | 508.48 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | [2-[3-[[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,2,4-triazin-6-yl]-5-(1,3-oxazol-2-yl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | CC1(C)C[C@H](Nc2ncc(-c3ccc(-c4ncco4)cc3OC(=O)C(F)(F)F)nn2)[C@H](F)C(C)(C)N1 |
| InChI | InChI=1S/C23H24F4N6O3/c1-21(2)10-14(17(24)22(3,4)33-21)30-20-29-11-15(31-32-20)13-6-5-12(18-28-7-8-35-18)9-16(13)36-19(34)23(25,26)27/h5-9,11,14,17,33H,10H2,1-4H3,(H,29,30,32)/t14-,17-/m0/s1 |
| InChIKey | RJORDWNHPODGGZ-YOEHRIQHSA-N |
| XLogP | 4.33 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|