C21H30ClN5O2 — CID 139537124
6-[4-chloro-2-(methoxymethoxy)phenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,2,4-triazin-3-amine (PubChem CID 139537124) has the molecular formula C21H30ClN5O2 and a molecular weight of 419.96 g/mol. Its IUPAC name is 6-[4-chloro-2-(methoxymethoxy)phenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,2,4-triazin-3-amine.
| Compound Name | 6-[4-chloro-2-(methoxymethoxy)phenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 139537124 |
| Molecular Formula | C21H30ClN5O2 |
| Molecular Weight | 419.96 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 6-[4-chloro-2-(methoxymethoxy)phenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,2,4-triazin-3-amine |
| SMILES | COCOc1cc(Cl)ccc1-c1cnc(N(C)C2CC(C)(C)NC(C)(C)C2)nn1 |
| InChI | InChI=1S/C21H30ClN5O2/c1-20(2)10-15(11-21(3,4)26-20)27(5)19-23-12-17(24-25-19)16-8-7-14(22)9-18(16)29-13-28-6/h7-9,12,15,26H,10-11,13H2,1-6H3 |
| InChIKey | GQJFNGNAMSKTAX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.96 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|