C23H23F3N6O3 — CID 139537142
[2-[3-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-1,2,4-triazin-6-yl]-5-(2-methyl-1,3-oxazol-5-yl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 139537142) has the molecular formula C23H23F3N6O3 and a molecular weight of 488.47 g/mol. Its IUPAC name is [2-[3-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-1,2,4-triazin-6-yl]-5-(2-methyl-1,3-oxazol-5-yl)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[3-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-1,2,4-triazin-6-yl]-5-(2-methyl-1,3-oxazol-5-yl)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 139537142 |
| Molecular Formula | C23H23F3N6O3 |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | [2-[3-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-1,2,4-triazin-6-yl]-5-(2-methyl-1,3-oxazol-5-yl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | Cc1ncc(-c2ccc(-c3cnc(N4CC5(CCN(C)CC5)C4)nn3)c(OC(=O)C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C23H23F3N6O3/c1-14-27-11-19(34-14)15-3-4-16(18(9-15)35-20(33)23(24,25)26)17-10-28-21(30-29-17)32-12-22(13-32)5-7-31(2)8-6-22/h3-4,9-11H,5-8,12-13H2,1-2H3 |
| InChIKey | NBLVAFLGYXFOGM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 97.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|