C25H27F4N7O3 — CID 139537170
[2-[3-[[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,2,4-triazin-6-yl]-5-(6-methoxypyrimidin-4-yl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 139537170) has the molecular formula C25H27F4N7O3 and a molecular weight of 549.53 g/mol. Its IUPAC name is [2-[3-[[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,2,4-triazin-6-yl]-5-(6-methoxypyrimidin-4-yl)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[3-[[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,2,4-triazin-6-yl]-5-(6-methoxypyrimidin-4-yl)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 139537170 |
| Molecular Formula | C25H27F4N7O3 |
| Molecular Weight | 549.53 g/mol |
| Exact Mass | 549.21 |
| IUPAC Name | [2-[3-[[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,2,4-triazin-6-yl]-5-(6-methoxypyrimidin-4-yl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | COc1cc(-c2ccc(-c3cnc(N[C@H]4CC(C)(C)NC(C)(C)[C@H]4F)nn3)c(OC(=O)C(F)(F)F)c2)ncn1 |
| InChI | InChI=1S/C25H27F4N7O3/c1-23(2)10-16(20(26)24(3,4)36-23)33-22-30-11-17(34-35-22)14-7-6-13(15-9-19(38-5)32-12-31-15)8-18(14)39-21(37)25(27,28)29/h6-9,11-12,16,20,36H,10H2,1-5H3,(H,30,33,35)/t16-,20-/m0/s1 |
| InChIKey | MFBOTCGFSADAFU-JXFKEZNVSA-N |
| XLogP | 4.14 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|