C14H9ClN4 — CID 139537357
5-chloro-2-(5-methyl-1H-pyrazol-4-yl)quinoline-3-carbonitrile (PubChem CID 139537357) has the molecular formula C14H9ClN4 and a molecular weight of 268.71 g/mol. Its IUPAC name is 5-chloro-2-(5-methyl-1H-pyrazol-4-yl)quinoline-3-carbonitrile.
| Compound Name | 5-chloro-2-(5-methyl-1H-pyrazol-4-yl)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 139537357 |
| Molecular Formula | C14H9ClN4 |
| Molecular Weight | 268.71 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 5-chloro-2-(5-methyl-1H-pyrazol-4-yl)quinoline-3-carbonitrile |
| SMILES | Cc1[nH]ncc1-c1nc2cccc(Cl)c2cc1C#N |
| InChI | InChI=1S/C14H9ClN4/c1-8-11(7-17-19-8)14-9(6-16)5-10-12(15)3-2-4-13(10)18-14/h2-5,7H,1H3,(H,17,19) |
| InChIKey | NLFMACYKYNPKQA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.71 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |