C23H26F4N8O2 — CID 139537459
[2-[3-[[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,2,4-triazin-6-yl]-5-(2-methyltriazol-4-yl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 139537459) has the molecular formula C23H26F4N8O2 and a molecular weight of 522.51 g/mol. Its IUPAC name is [2-[3-[[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,2,4-triazin-6-yl]-5-(2-methyltriazol-4-yl)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[3-[[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,2,4-triazin-6-yl]-5-(2-methyltriazol-4-yl)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 139537459 |
| Molecular Formula | C23H26F4N8O2 |
| Molecular Weight | 522.51 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | [2-[3-[[(3S,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,2,4-triazin-6-yl]-5-(2-methyltriazol-4-yl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | Cn1ncc(-c2ccc(-c3cnc(N[C@H]4CC(C)(C)NC(C)(C)[C@H]4F)nn3)c(OC(=O)C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C23H26F4N8O2/c1-21(2)9-14(18(24)22(3,4)34-21)30-20-28-10-16(31-32-20)13-7-6-12(15-11-29-35(5)33-15)8-17(13)37-19(36)23(25,26)27/h6-8,10-11,14,18,34H,9H2,1-5H3,(H,28,30,32)/t14-,18-/m0/s1 |
| InChIKey | CRFAGAYHSOLPGR-KSSFIOAISA-N |
| XLogP | 3.47 |
| TPSA | 119.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|