C23H26F3N7O2 — CID 139537613
[2-[3-[3-(tert-butylamino)piperidin-1-yl]-1,2,4-triazin-6-yl]-5-(1H-pyrazol-4-yl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 139537613) has the molecular formula C23H26F3N7O2 and a molecular weight of 489.50 g/mol. Its IUPAC name is [2-[3-[3-(tert-butylamino)piperidin-1-yl]-1,2,4-triazin-6-yl]-5-(1H-pyrazol-4-yl)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[3-[3-(tert-butylamino)piperidin-1-yl]-1,2,4-triazin-6-yl]-5-(1H-pyrazol-4-yl)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 139537613 |
| Molecular Formula | C23H26F3N7O2 |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | [2-[3-[3-(tert-butylamino)piperidin-1-yl]-1,2,4-triazin-6-yl]-5-(1H-pyrazol-4-yl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | CC(C)(C)NC1CCCN(c2ncc(-c3ccc(-c4cn[nH]c4)cc3OC(=O)C(F)(F)F)nn2)C1 |
| InChI | InChI=1S/C23H26F3N7O2/c1-22(2,3)30-16-5-4-8-33(13-16)21-27-12-18(31-32-21)17-7-6-14(15-10-28-29-11-15)9-19(17)35-20(34)23(24,25)26/h6-7,9-12,16,30H,4-5,8,13H2,1-3H3,(H,28,29) |
| InChIKey | SIQRDOXLAFSSSZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|