About 2,6-dibromoaniline;3,5-dibromoaniline
2,6-dibromoaniline;3,5-dibromoaniline (PubChem CID 139537880) has the molecular formula C12H10Br4N2
and a molecular weight of 501.84 g/mol. Its IUPAC name is 2,6-dibromoaniline;3,5-dibromoaniline.
Molecular Properties
| Compound Name | 2,6-dibromoaniline;3,5-dibromoaniline |
| PubChem CID | 139537880 |
| Molecular Formula | C12H10Br4N2 |
| Molecular Weight | 501.84 g/mol |
| Exact Mass | 497.76 |
| IUPAC Name | 2,6-dibromoaniline;3,5-dibromoaniline |
| SMILES | Nc1c(Br)cccc1Br.Nc1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/2C6H5Br2N/c7-4-1-5(8)3-6(9)2-4;7-4-2-1-3-5(8)6(4)9/h2*1-3H,9H2 |
| InChIKey | LFODMCAQUQOALP-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 501.84 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dibromoaniline;3,5-dibromoaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dibromoaniline;3,5-dibromoaniline?
The IUPAC name of 2,6-dibromoaniline;3,5-dibromoaniline (CID 139537880) is 2,6-dibromoaniline;3,5-dibromoaniline.
What is the SMILES notation for 2,6-dibromoaniline;3,5-dibromoaniline?
The canonical SMILES for 2,6-dibromoaniline;3,5-dibromoaniline is Nc1c(Br)cccc1Br.Nc1cc(Br)cc(Br)c1.
What is the InChIKey of 2,6-dibromoaniline;3,5-dibromoaniline?
The InChIKey is LFODMCAQUQOALP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H5Br2N/c7-4-1-5(8)3-6(9)2-4;7-4-2-1-3-5(8)6(4)9/h2*1-3H,9H2.
What are the key properties of 2,6-dibromoaniline;3,5-dibromoaniline?
2,6-dibromoaniline;3,5-dibromoaniline has a molecular weight of 501.84 g/mol, XLogP of 5.59, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dibromoaniline;3,5-dibromoaniline is sourced from PubChem (CID 139537880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).