C16H20N6O3S — CID 139538417
methyl 6-[[(8aR)-3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl]methyl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 139538417) has the molecular formula C16H20N6O3S and a molecular weight of 376.44 g/mol. Its IUPAC name is methyl 6-[[(8aR)-3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl]methyl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | methyl 6-[[(8aR)-3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl]methyl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 139538417 |
| Molecular Formula | C16H20N6O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | methyl 6-[[(8aR)-3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl]methyl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(CN2CCN3C(=O)NC[C@@H]3C2)NC(c2nccs2)=NC1 |
| InChI | InChI=1S/C16H20N6O3S/c1-25-15(23)11-7-18-13(14-17-2-5-26-14)20-12(11)9-21-3-4-22-10(8-21)6-19-16(22)24/h2,5,10H,3-4,6-9H2,1H3,(H,18,20)(H,19,24)/t10-/m1/s1 |
| InChIKey | OBIRNZWVGNLVKD-SNVBAGLBSA-N |
| XLogP | -0.37 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |