About [(E)-2-(methylamino)pent-2-enyl] methanedithioate
[(E)-2-(methylamino)pent-2-enyl] methanedithioate (PubChem CID 139539536) has the molecular formula C7H13NS2
and a molecular weight of 175.32 g/mol. Its IUPAC name is [(E)-2-(methylamino)pent-2-enyl] methanedithioate.
Molecular Properties
| Compound Name | [(E)-2-(methylamino)pent-2-enyl] methanedithioate |
| PubChem CID | 139539536 |
| Molecular Formula | C7H13NS2 |
| Molecular Weight | 175.32 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | [(E)-2-(methylamino)pent-2-enyl] methanedithioate |
| SMILES | CC/C=C(\CSC=S)NC |
| InChI | InChI=1S/C7H13NS2/c1-3-4-7(8-2)5-10-6-9/h4,6,8H,3,5H2,1-2H3/b7-4+ |
| InChIKey | JVBYGYGOXSEOIB-QPJJXVBHSA-N |
| XLogP | 2.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(E)-2-(methylamino)pent-2-enyl] methanedithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-2-(methylamino)pent-2-enyl] methanedithioate?
The IUPAC name of [(E)-2-(methylamino)pent-2-enyl] methanedithioate (CID 139539536) is [(E)-2-(methylamino)pent-2-enyl] methanedithioate.
What is the SMILES notation for [(E)-2-(methylamino)pent-2-enyl] methanedithioate?
The canonical SMILES for [(E)-2-(methylamino)pent-2-enyl] methanedithioate is CC/C=C(\CSC=S)NC.
What is the InChIKey of [(E)-2-(methylamino)pent-2-enyl] methanedithioate?
The InChIKey is JVBYGYGOXSEOIB-QPJJXVBHSA-N. The full InChI is InChI=1S/C7H13NS2/c1-3-4-7(8-2)5-10-6-9/h4,6,8H,3,5H2,1-2H3/b7-4+.
What are the key properties of [(E)-2-(methylamino)pent-2-enyl] methanedithioate?
[(E)-2-(methylamino)pent-2-enyl] methanedithioate has a molecular weight of 175.32 g/mol, XLogP of 2.19, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-2-(methylamino)pent-2-enyl] methanedithioate is sourced from PubChem (CID 139539536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).