C22H35NO — CID 139539943
(2E,4Z)-N-[(E)-3-cyclohexylprop-2-enyl]-N-methyl-3-methylidene-2-(propoxymethylidene)hepta-4,6-dien-1-amine (PubChem CID 139539943) has the molecular formula C22H35NO and a molecular weight of 329.53 g/mol. Its IUPAC name is (2E,4Z)-N-[(E)-3-cyclohexylprop-2-enyl]-N-methyl-3-methylidene-2-(propoxymethylidene)hepta-4,6-dien-1-amine.
| Compound Name | (2E,4Z)-N-[(E)-3-cyclohexylprop-2-enyl]-N-methyl-3-methylidene-2-(propoxymethylidene)hepta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 139539943 |
| Molecular Formula | C22H35NO |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.27 |
| IUPAC Name | (2E,4Z)-N-[(E)-3-cyclohexylprop-2-enyl]-N-methyl-3-methylidene-2-(propoxymethylidene)hepta-4,6-dien-1-amine |
| SMILES | C=C/C=C\C(=C)/C(=C\OCCC)CN(C)C/C=C/C1CCCCC1 |
| InChI | InChI=1S/C22H35NO/c1-5-7-12-20(3)22(19-24-17-6-2)18-23(4)16-11-15-21-13-9-8-10-14-21/h5,7,11-12,15,19,21H,1,3,6,8-10,13-14,16-18H2,2,4H3/b12-7-,15-11+,22-19- |
| InChIKey | TWPPNTBNVZDCGV-YYJASTQNSA-N |
| XLogP | 5.66 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|