About [(Z)-but-2-enyl] 2-(methylamino)acetate
[(Z)-but-2-enyl] 2-(methylamino)acetate (PubChem CID 139540657) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is [(Z)-but-2-enyl] 2-(methylamino)acetate.
Molecular Properties
| Compound Name | [(Z)-but-2-enyl] 2-(methylamino)acetate |
| PubChem CID | 139540657 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | [(Z)-but-2-enyl] 2-(methylamino)acetate |
| SMILES | C/C=C\COC(=O)CNC |
| InChI | InChI=1S/C7H13NO2/c1-3-4-5-10-7(9)6-8-2/h3-4,8H,5-6H2,1-2H3/b4-3- |
| InChIKey | BZISUEGJHCUZFD-ARJAWSKDSA-N |
| XLogP | 0.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-but-2-enyl] 2-(methylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-but-2-enyl] 2-(methylamino)acetate?
The IUPAC name of [(Z)-but-2-enyl] 2-(methylamino)acetate (CID 139540657) is [(Z)-but-2-enyl] 2-(methylamino)acetate.
What is the SMILES notation for [(Z)-but-2-enyl] 2-(methylamino)acetate?
The canonical SMILES for [(Z)-but-2-enyl] 2-(methylamino)acetate is C/C=C\COC(=O)CNC.
What is the InChIKey of [(Z)-but-2-enyl] 2-(methylamino)acetate?
The InChIKey is BZISUEGJHCUZFD-ARJAWSKDSA-N. The full InChI is InChI=1S/C7H13NO2/c1-3-4-5-10-7(9)6-8-2/h3-4,8H,5-6H2,1-2H3/b4-3-.
What are the key properties of [(Z)-but-2-enyl] 2-(methylamino)acetate?
[(Z)-but-2-enyl] 2-(methylamino)acetate has a molecular weight of 143.19 g/mol, XLogP of 0.33, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-but-2-enyl] 2-(methylamino)acetate is sourced from PubChem (CID 139540657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).