C16H25N5O2 — CID 139540677
tert-butyl N-[1-(4-amino-6-methyl-5,6-dihydropyrrolo[2,3-d]pyrimidin-7-yl)but-3-en-2-yl]carbamate (PubChem CID 139540677) has the molecular formula C16H25N5O2 and a molecular weight of 319.41 g/mol. Its IUPAC name is tert-butyl N-[1-(4-amino-6-methyl-5,6-dihydropyrrolo[2,3-d]pyrimidin-7-yl)but-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(4-amino-6-methyl-5,6-dihydropyrrolo[2,3-d]pyrimidin-7-yl)but-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 139540677 |
| Molecular Formula | C16H25N5O2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | tert-butyl N-[1-(4-amino-6-methyl-5,6-dihydropyrrolo[2,3-d]pyrimidin-7-yl)but-3-en-2-yl]carbamate |
| SMILES | C=CC(CN1c2ncnc(N)c2CC1C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25N5O2/c1-6-11(20-15(22)23-16(3,4)5)8-21-10(2)7-12-13(17)18-9-19-14(12)21/h6,9-11H,1,7-8H2,2-5H3,(H,20,22)(H2,17,18,19) |
| InChIKey | DYTLWCHNDRXZEL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|