C20H24O6 — CID 139540684
[(3S,7R,8R,9E,12R)-5-hydroxy-10-methyl-6-methylidene-14-oxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] 3-methylbut-2-enoate (PubChem CID 139540684) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is [(3S,7R,8R,9E,12R)-5-hydroxy-10-methyl-6-methylidene-14-oxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] 3-methylbut-2-enoate.
| Compound Name | [(3S,7R,8R,9E,12R)-5-hydroxy-10-methyl-6-methylidene-14-oxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 139540684 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | [(3S,7R,8R,9E,12R)-5-hydroxy-10-methyl-6-methylidene-14-oxo-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),9-dien-8-yl] 3-methylbut-2-enoate |
| SMILES | C=C1C(O)O[C@H]2CC3=C[C@@H](C/C(C)=C/[C@@H](OC(=O)C=C(C)C)[C@H]12)OC3=O |
| InChI | InChI=1S/C20H24O6/c1-10(2)5-17(21)25-15-7-11(3)6-14-8-13(20(23)24-14)9-16-18(15)12(4)19(22)26-16/h5,7-8,14-16,18-19,22H,4,6,9H2,1-3H3/b11-7+/t14-,15-,16+,18+,19?/m1/s1 |
| InChIKey | ZEJIGLUVRRVXFL-MECOEMQJSA-N |
| XLogP | 2.35 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|