C21H26O6 — CID 139540805
[(8S,9R,10E,13R)-11-methyl-7-methylidene-6,15-dioxo-5,14-dioxatricyclo[11.2.1.03,8]hexadeca-1(16),10-dien-9-yl] 3-methylbutanoate (PubChem CID 139540805) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is [(8S,9R,10E,13R)-11-methyl-7-methylidene-6,15-dioxo-5,14-dioxatricyclo[11.2.1.03,8]hexadeca-1(16),10-dien-9-yl] 3-methylbutanoate.
| Compound Name | [(8S,9R,10E,13R)-11-methyl-7-methylidene-6,15-dioxo-5,14-dioxatricyclo[11.2.1.03,8]hexadeca-1(16),10-dien-9-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 139540805 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | [(8S,9R,10E,13R)-11-methyl-7-methylidene-6,15-dioxo-5,14-dioxatricyclo[11.2.1.03,8]hexadeca-1(16),10-dien-9-yl] 3-methylbutanoate |
| SMILES | C=C1C(=O)OCC2CC3=C[C@@H](C/C(C)=C/[C@@H](OC(=O)CC(C)C)[C@H]12)OC3=O |
| InChI | InChI=1S/C21H26O6/c1-11(2)5-18(22)27-17-7-12(3)6-16-9-14(21(24)26-16)8-15-10-25-20(23)13(4)19(15)17/h7,9,11,15-17,19H,4-6,8,10H2,1-3H3/b12-7+/t15?,16-,17-,19-/m1/s1 |
| InChIKey | IREFUGZWXNPUNZ-RCZRIJHYSA-N |
| XLogP | 2.88 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|