C26H20F3N3O2 — CID 139541055
(3S)-12-(2-cyclopropylpyrimidin-5-yl)-3-[2-(difluoromethoxy)phenyl]-11-fluoro-4-oxa-8-azatricyclo[7.5.0.02,7]tetradeca-1,7,9,11,13-pentaene (PubChem CID 139541055) has the molecular formula C26H20F3N3O2 and a molecular weight of 463.46 g/mol. Its IUPAC name is (3S)-12-(2-cyclopropylpyrimidin-5-yl)-3-[2-(difluoromethoxy)phenyl]-11-fluoro-4-oxa-8-azatricyclo[7.5.0.02,7]tetradeca-1,7,9,11,13-pentaene.
| Compound Name | (3S)-12-(2-cyclopropylpyrimidin-5-yl)-3-[2-(difluoromethoxy)phenyl]-11-fluoro-4-oxa-8-azatricyclo[7.5.0.02,7]tetradeca-1,7,9,11,13-pentaene |
|---|---|
| PubChem CID | 139541055 |
| Molecular Formula | C26H20F3N3O2 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | (3S)-12-(2-cyclopropylpyrimidin-5-yl)-3-[2-(difluoromethoxy)phenyl]-11-fluoro-4-oxa-8-azatricyclo[7.5.0.02,7]tetradeca-1,7,9,11,13-pentaene |
| SMILES | Fc1cc2nc3c(c-2ccc1-c1cnc(C2CC2)nc1)[C@@H](c1ccccc1OC(F)F)OCC3 |
| InChI | InChI=1S/C26H20F3N3O2/c27-19-11-21-17(8-7-16(19)15-12-30-25(31-13-15)14-5-6-14)23-20(32-21)9-10-33-24(23)18-3-1-2-4-22(18)34-26(28)29/h1-4,7-8,11-14,24,26H,5-6,9-10H2/t24-/m1/s1 |
| InChIKey | GSZGCVKTVUNFCC-XMMPIXPASA-N |
| XLogP | 5.92 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |