C14H20F2O2 — CID 139541115
(1S)-1-fluoro-1-(7-fluoro-5-pentoxycyclohepta-1,3,5-trien-1-yl)ethanol (PubChem CID 139541115) has the molecular formula C14H20F2O2 and a molecular weight of 258.31 g/mol. Its IUPAC name is (1S)-1-fluoro-1-(7-fluoro-5-pentoxycyclohepta-1,3,5-trien-1-yl)ethanol.
| Compound Name | (1S)-1-fluoro-1-(7-fluoro-5-pentoxycyclohepta-1,3,5-trien-1-yl)ethanol |
|---|---|
| PubChem CID | 139541115 |
| Molecular Formula | C14H20F2O2 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | (1S)-1-fluoro-1-(7-fluoro-5-pentoxycyclohepta-1,3,5-trien-1-yl)ethanol |
| SMILES | CCCCCOC1=CC(F)C([C@@](C)(O)F)=CC=C1 |
| InChI | InChI=1S/C14H20F2O2/c1-3-4-5-9-18-11-7-6-8-12(13(15)10-11)14(2,16)17/h6-8,10,13,17H,3-5,9H2,1-2H3/t13?,14-/m1/s1 |
| InChIKey | INVKSDYADIWXSP-ARLHGKGLSA-N |
| XLogP | 3.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|