About 5-(1,1-difluoropropyl)-2-[1-(dimethylamino)-2-methylpropan-2-yl]cyclohexa-1,5-dien-1-amine
5-(1,1-difluoropropyl)-2-[1-(dimethylamino)-2-methylpropan-2-yl]cyclohexa-1,5-dien-1-amine (PubChem CID 139541178) has the molecular formula C15H26F2N2
and a molecular weight of 272.38 g/mol. Its IUPAC name is 5-(1,1-difluoropropyl)-2-[1-(dimethylamino)-2-methylpropan-2-yl]cyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 5-(1,1-difluoropropyl)-2-[1-(dimethylamino)-2-methylpropan-2-yl]cyclohexa-1,5-dien-1-amine |
| PubChem CID | 139541178 |
| Molecular Formula | C15H26F2N2 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | 5-(1,1-difluoropropyl)-2-[1-(dimethylamino)-2-methylpropan-2-yl]cyclohexa-1,5-dien-1-amine |
| SMILES | CCC(F)(F)C1=CC(N)=C(C(C)(C)CN(C)C)CC1 |
| InChI | InChI=1S/C15H26F2N2/c1-6-15(16,17)11-7-8-12(13(18)9-11)14(2,3)10-19(4)5/h9H,6-8,10,18H2,1-5H3 |
| InChIKey | XBVVIDLMOLXODF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(1,1-difluoropropyl)-2-[1-(dimethylamino)-2-methylpropan-2-yl]cyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,1-difluoropropyl)-2-[1-(dimethylamino)-2-methylpropan-2-yl]cyclohexa-1,5-dien-1-amine?
The IUPAC name of 5-(1,1-difluoropropyl)-2-[1-(dimethylamino)-2-methylpropan-2-yl]cyclohexa-1,5-dien-1-amine (CID 139541178) is 5-(1,1-difluoropropyl)-2-[1-(dimethylamino)-2-methylpropan-2-yl]cyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 5-(1,1-difluoropropyl)-2-[1-(dimethylamino)-2-methylpropan-2-yl]cyclohexa-1,5-dien-1-amine?
The canonical SMILES for 5-(1,1-difluoropropyl)-2-[1-(dimethylamino)-2-methylpropan-2-yl]cyclohexa-1,5-dien-1-amine is CCC(F)(F)C1=CC(N)=C(C(C)(C)CN(C)C)CC1.
What is the InChIKey of 5-(1,1-difluoropropyl)-2-[1-(dimethylamino)-2-methylpropan-2-yl]cyclohexa-1,5-dien-1-amine?
The InChIKey is XBVVIDLMOLXODF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26F2N2/c1-6-15(16,17)11-7-8-12(13(18)9-11)14(2,3)10-19(4)5/h9H,6-8,10,18H2,1-5H3.
What are the key properties of 5-(1,1-difluoropropyl)-2-[1-(dimethylamino)-2-methylpropan-2-yl]cyclohexa-1,5-dien-1-amine?
5-(1,1-difluoropropyl)-2-[1-(dimethylamino)-2-methylpropan-2-yl]cyclohexa-1,5-dien-1-amine has a molecular weight of 272.38 g/mol, XLogP of 3.55, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,1-difluoropropyl)-2-[1-(dimethylamino)-2-methylpropan-2-yl]cyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 139541178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).