C19H24FN — CID 139541254
N-(cyclopropylmethyl)-2-fluoro-5-[(3E,5Z)-6-methylocta-3,5-dien-1-yn-4-yl]cyclohexa-1,5-dien-1-amine (PubChem CID 139541254) has the molecular formula C19H24FN and a molecular weight of 285.41 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-fluoro-5-[(3E,5Z)-6-methylocta-3,5-dien-1-yn-4-yl]cyclohexa-1,5-dien-1-amine.
| Compound Name | N-(cyclopropylmethyl)-2-fluoro-5-[(3E,5Z)-6-methylocta-3,5-dien-1-yn-4-yl]cyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 139541254 |
| Molecular Formula | C19H24FN |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | N-(cyclopropylmethyl)-2-fluoro-5-[(3E,5Z)-6-methylocta-3,5-dien-1-yn-4-yl]cyclohexa-1,5-dien-1-amine |
| SMILES | C#C/C=C(\C=C(\C)CC)C1=CC(NCC2CC2)=C(F)CC1 |
| InChI | InChI=1S/C19H24FN/c1-4-6-16(11-14(3)5-2)17-9-10-18(20)19(12-17)21-13-15-7-8-15/h1,6,11-12,15,21H,5,7-10,13H2,2-3H3/b14-11-,16-6+ |
| InChIKey | YJSRBMDRWKQEOP-XMURBJIESA-N |
| XLogP | 4.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|