C10H9F3N2O2S — CID 139541366
3-[2-nitro-4-(trifluoromethyl)phenyl]-1,3-thiazolidine (PubChem CID 139541366) has the molecular formula C10H9F3N2O2S and a molecular weight of 278.25 g/mol. Its IUPAC name is 3-[2-nitro-4-(trifluoromethyl)phenyl]-1,3-thiazolidine.
| Compound Name | 3-[2-nitro-4-(trifluoromethyl)phenyl]-1,3-thiazolidine |
|---|---|
| PubChem CID | 139541366 |
| Molecular Formula | C10H9F3N2O2S |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 3-[2-nitro-4-(trifluoromethyl)phenyl]-1,3-thiazolidine |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1N1CCSC1 |
| InChI | InChI=1S/C10H9F3N2O2S/c11-10(12,13)7-1-2-8(9(5-7)15(16)17)14-3-4-18-6-14/h1-2,5H,3-4,6H2 |
| InChIKey | IHDKHGXJUVBLJZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|